C33H34O3S2 — CID 87320010
(2R,3S,4S,5S)-3,4-dibenzyl-2-benzylsulfanyl-5-(1-hydroxy-2-phenylethyl)thiolane-3,4-diol (PubChem CID 87320010) has the molecular formula C33H34O3S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3,4-dibenzyl-2-benzylsulfanyl-5-(1-hydroxy-2-phenylethyl)thiolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-3,4-dibenzyl-2-benzylsulfanyl-5-(1-hydroxy-2-phenylethyl)thiolane-3,4-diol |
|---|---|
| PubChem CID | 87320010 |
| Molecular Formula | C33H34O3S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (2R,3S,4S,5S)-3,4-dibenzyl-2-benzylsulfanyl-5-(1-hydroxy-2-phenylethyl)thiolane-3,4-diol |
| SMILES | OC(Cc1ccccc1)[C@@H]1S[C@@H](SCc2ccccc2)[C@](O)(Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C33H34O3S2/c34-29(21-25-13-5-1-6-14-25)30-32(35,22-26-15-7-2-8-16-26)33(36,23-27-17-9-3-10-18-27)31(38-30)37-24-28-19-11-4-12-20-28/h1-20,29-31,34-36H,21-24H2/t29?,30-,31+,32+,33+/m0/s1 |
| InChIKey | VXUXAKRBOVCGLD-RVYFFIJCSA-N |
| XLogP | 5.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |