C27H17Cl2N3O4S — CID 87320058
3-[[(2R,3S)-2,3-bis(4-chlorophenyl)-6-formyl-5-oxo-2,3-dihydroimidazo[1,2-a]pyridin-1-yl]sulfonyl]benzonitrile (PubChem CID 87320058) has the molecular formula C27H17Cl2N3O4S and a molecular weight of 550.42 g/mol. Its IUPAC name is 3-[[(2R,3S)-2,3-bis(4-chlorophenyl)-6-formyl-5-oxo-2,3-dihydroimidazo[1,2-a]pyridin-1-yl]sulfonyl]benzonitrile.
| Compound Name | 3-[[(2R,3S)-2,3-bis(4-chlorophenyl)-6-formyl-5-oxo-2,3-dihydroimidazo[1,2-a]pyridin-1-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 87320058 |
| Molecular Formula | C27H17Cl2N3O4S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 549.03 |
| IUPAC Name | 3-[[(2R,3S)-2,3-bis(4-chlorophenyl)-6-formyl-5-oxo-2,3-dihydroimidazo[1,2-a]pyridin-1-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1cccc(S(=O)(=O)N2c3ccc(C=O)c(=O)n3[C@@H](c3ccc(Cl)cc3)[C@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H17Cl2N3O4S/c28-21-9-4-18(5-10-21)25-26(19-6-11-22(29)12-7-19)32(24-13-8-20(16-33)27(34)31(24)25)37(35,36)23-3-1-2-17(14-23)15-30/h1-14,16,25-26H/t25-,26+/m0/s1 |
| InChIKey | DULPSNZKXVVPGP-IZZNHLLZSA-N |
| XLogP | 5.38 |
| TPSA | 100.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|