C13H20N4O5S2 — CID 87320329
(4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid;(2S)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)-2-(trimethylazaniumyl)propanoate (PubChem CID 87320329) has the molecular formula C13H20N4O5S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid;(2S)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)-2-(trimethylazaniumyl)propanoate.
| Compound Name | (4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid;(2S)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)-2-(trimethylazaniumyl)propanoate |
|---|---|
| PubChem CID | 87320329 |
| Molecular Formula | C13H20N4O5S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (4R)-2-oxo-1,3-thiazolidine-4-carboxylic acid;(2S)-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)-2-(trimethylazaniumyl)propanoate |
| SMILES | C[N+](C)(C)[C@@H](Cc1c[nH]c(=S)[nH]1)C(=O)[O-].O=C1N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C9H15N3O2S.C4H5NO3S/c1-12(2,3)7(8(13)14)4-6-5-10-9(15)11-6;6-3(7)2-1-9-4(8)5-2/h5,7H,4H2,1-3H3,(H2-,10,11,13,14,15);2H,1H2,(H,5,8)(H,6,7)/t7-;2-/m00/s1 |
| InChIKey | FYFVLBDDSLXLRP-JECGBWMKSA-N |
| XLogP | -0.66 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|