About titanium;tris(2-methylpropoxy)methanol
titanium;tris(2-methylpropoxy)methanol (PubChem CID 87320459) has the molecular formula C13H28O4Ti
and a molecular weight of 296.23 g/mol. Its IUPAC name is titanium;tris(2-methylpropoxy)methanol.
Molecular Properties
| Compound Name | titanium;tris(2-methylpropoxy)methanol |
| PubChem CID | 87320459 |
| Molecular Formula | C13H28O4Ti |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | titanium;tris(2-methylpropoxy)methanol |
| SMILES | CC(C)COC(O)(OCC(C)C)OCC(C)C.[Ti] |
| InChI | InChI=1S/C13H28O4.Ti/c1-10(2)7-15-13(14,16-8-11(3)4)17-9-12(5)6;/h10-12,14H,7-9H2,1-6H3; |
| InChIKey | BZSHYLFTRZGVAT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze titanium;tris(2-methylpropoxy)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of titanium;tris(2-methylpropoxy)methanol?
The IUPAC name of titanium;tris(2-methylpropoxy)methanol (CID 87320459) is titanium;tris(2-methylpropoxy)methanol.
What is the SMILES notation for titanium;tris(2-methylpropoxy)methanol?
The canonical SMILES for titanium;tris(2-methylpropoxy)methanol is CC(C)COC(O)(OCC(C)C)OCC(C)C.[Ti].
What is the InChIKey of titanium;tris(2-methylpropoxy)methanol?
The InChIKey is BZSHYLFTRZGVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O4.Ti/c1-10(2)7-15-13(14,16-8-11(3)4)17-9-12(5)6;/h10-12,14H,7-9H2,1-6H3;.
What are the key properties of titanium;tris(2-methylpropoxy)methanol?
titanium;tris(2-methylpropoxy)methanol has a molecular weight of 296.23 g/mol, XLogP of 2.61, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for titanium;tris(2-methylpropoxy)methanol is sourced from PubChem (CID 87320459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).