C42H36F3O7S2+ — CID 87320621
[9,9-bis(4-methoxyphenyl)fluoren-2-yl]-bis(4-methoxyphenyl)sulfanium;trifluoromethanesulfonic acid (PubChem CID 87320621) has the molecular formula C42H36F3O7S2+ and a molecular weight of 773.87 g/mol. Its IUPAC name is [9,9-bis(4-methoxyphenyl)fluoren-2-yl]-bis(4-methoxyphenyl)sulfanium;trifluoromethanesulfonic acid.
| Compound Name | [9,9-bis(4-methoxyphenyl)fluoren-2-yl]-bis(4-methoxyphenyl)sulfanium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87320621 |
| Molecular Formula | C42H36F3O7S2+ |
| Molecular Weight | 773.87 g/mol |
| Exact Mass | 773.18 |
| IUPAC Name | [9,9-bis(4-methoxyphenyl)fluoren-2-yl]-bis(4-methoxyphenyl)sulfanium;trifluoromethanesulfonic acid |
| SMILES | COc1ccc([S+](c2ccc(OC)cc2)c2ccc3c(c2)C(c2ccc(OC)cc2)(c2ccc(OC)cc2)c2ccccc2-3)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C41H35O4S.CHF3O3S/c1-42-30-13-9-28(10-14-30)41(29-11-15-31(43-2)16-12-29)39-8-6-5-7-37(39)38-26-25-36(27-40(38)41)46(34-21-17-32(44-3)18-22-34)35-23-19-33(45-4)20-24-35;2-1(3,4)8(5,6)7/h5-27H,1-4H3;(H,5,6,7)/q+1; |
| InChIKey | WZZSREOBUDSQEZ-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.87 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|