About 1,1,2-tris(2-methylpropoxy)ethanol;zirconium
1,1,2-tris(2-methylpropoxy)ethanol;zirconium (PubChem CID 87320742) has the molecular formula C14H30O4Zr
and a molecular weight of 353.61 g/mol. Its IUPAC name is 1,1,2-tris(2-methylpropoxy)ethanol;zirconium.
Molecular Properties
| Compound Name | 1,1,2-tris(2-methylpropoxy)ethanol;zirconium |
| PubChem CID | 87320742 |
| Molecular Formula | C14H30O4Zr |
| Molecular Weight | 353.61 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1,1,2-tris(2-methylpropoxy)ethanol;zirconium |
| SMILES | CC(C)COCC(O)(OCC(C)C)OCC(C)C.[Zr] |
| InChI | InChI=1S/C14H30O4.Zr/c1-11(2)7-16-10-14(15,17-8-12(3)4)18-9-13(5)6;/h11-13,15H,7-10H2,1-6H3; |
| InChIKey | RXNCVLCKFHQXBB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-tris(2-methylpropoxy)ethanol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-tris(2-methylpropoxy)ethanol;zirconium?
The IUPAC name of 1,1,2-tris(2-methylpropoxy)ethanol;zirconium (CID 87320742) is 1,1,2-tris(2-methylpropoxy)ethanol;zirconium.
What is the SMILES notation for 1,1,2-tris(2-methylpropoxy)ethanol;zirconium?
The canonical SMILES for 1,1,2-tris(2-methylpropoxy)ethanol;zirconium is CC(C)COCC(O)(OCC(C)C)OCC(C)C.[Zr].
What is the InChIKey of 1,1,2-tris(2-methylpropoxy)ethanol;zirconium?
The InChIKey is RXNCVLCKFHQXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4.Zr/c1-11(2)7-16-10-14(15,17-8-12(3)4)18-9-13(5)6;/h11-13,15H,7-10H2,1-6H3;.
What are the key properties of 1,1,2-tris(2-methylpropoxy)ethanol;zirconium?
1,1,2-tris(2-methylpropoxy)ethanol;zirconium has a molecular weight of 353.61 g/mol, XLogP of 2.65, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-tris(2-methylpropoxy)ethanol;zirconium is sourced from PubChem (CID 87320742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).