About benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine
benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine (PubChem CID 87320807) has the molecular formula C19H19N3O
and a molecular weight of 305.38 g/mol. Its IUPAC name is benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 87320807 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine |
| SMILES | C#Cc1c(C2CCOCC2)nn2cccnc12.c1ccccc1 |
| InChI | InChI=1S/C13H13N3O.C6H6/c1-2-11-12(10-4-8-17-9-5-10)15-16-7-3-6-14-13(11)16;1-2-4-6-5-3-1/h1,3,6-7,10H,4-5,8-9H2;1-6H |
| InChIKey | HNSUXXHERKSXEQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine?
The IUPAC name of benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine (CID 87320807) is benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine is C#Cc1c(C2CCOCC2)nn2cccnc12.c1ccccc1.
What is the InChIKey of benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine?
The InChIKey is HNSUXXHERKSXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O.C6H6/c1-2-11-12(10-4-8-17-9-5-10)15-16-7-3-6-14-13(11)16;1-2-4-6-5-3-1/h1,3,6-7,10H,4-5,8-9H2;1-6H.
What are the key properties of benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine?
benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine has a molecular weight of 305.38 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;3-ethynyl-2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 87320807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).