About [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid
[2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid (PubChem CID 87320818) has the molecular formula C9H13F3N2O3
and a molecular weight of 254.21 g/mol. Its IUPAC name is [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid |
| PubChem CID | 87320818 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCCCC1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c10-9(11,12)7(15)13-5-3-1-2-4-6(5)14-8(16)17/h5-6,14H,1-4H2,(H,13,15)(H,16,17) |
| InChIKey | UZWIGKPRRHISFC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid?
The IUPAC name of [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid (CID 87320818) is [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid.
What is the SMILES notation for [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid?
The canonical SMILES for [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid is O=C(O)NC1CCCCC1NC(=O)C(F)(F)F.
What is the InChIKey of [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid?
The InChIKey is UZWIGKPRRHISFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2O3/c10-9(11,12)7(15)13-5-3-1-2-4-6(5)14-8(16)17/h5-6,14H,1-4H2,(H,13,15)(H,16,17).
What are the key properties of [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid?
[2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid has a molecular weight of 254.21 g/mol, XLogP of 1.24, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl]carbamic acid is sourced from PubChem (CID 87320818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).