C25H21FN6O2S — CID 87321117
3-[2-[4-(aziridin-1-yl)-3-fluoropiperidin-1-yl]quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione (PubChem CID 87321117) has the molecular formula C25H21FN6O2S and a molecular weight of 488.55 g/mol. Its IUPAC name is 3-[2-[4-(aziridin-1-yl)-3-fluoropiperidin-1-yl]quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione.
| Compound Name | 3-[2-[4-(aziridin-1-yl)-3-fluoropiperidin-1-yl]quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87321117 |
| Molecular Formula | C25H21FN6O2S |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-[2-[4-(aziridin-1-yl)-3-fluoropiperidin-1-yl]quinazolin-4-yl]-4-(6H-thieno[2,3-b]pyrrol-4-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3sccc23)=C1c1nc(N2CCC(N3CC3)C(F)C2)nc2ccccc12 |
| InChI | InChI=1S/C25H21FN6O2S/c26-16-12-32(7-5-18(16)31-8-9-31)25-28-17-4-2-1-3-14(17)21(29-25)20-19(22(33)30-23(20)34)15-11-27-24-13(15)6-10-35-24/h1-4,6,10-11,16,18,27H,5,7-9,12H2,(H,30,33,34) |
| InChIKey | QABFHDHFJCSWJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|