About tetracyanoboranuide;triethyl(methyl)azanium
tetracyanoboranuide;triethyl(methyl)azanium (PubChem CID 87321369) has the molecular formula C11H18BN5
and a molecular weight of 231.11 g/mol. Its IUPAC name is tetracyanoboranuide;triethyl(methyl)azanium.
Molecular Properties
| Compound Name | tetracyanoboranuide;triethyl(methyl)azanium |
| PubChem CID | 87321369 |
| Molecular Formula | C11H18BN5 |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | tetracyanoboranuide;triethyl(methyl)azanium |
| SMILES | CC[N+](C)(CC)CC.N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C7H18N.C4BN4/c1-5-8(4,6-2)7-3;6-1-5(2-7,3-8)4-9/h5-7H2,1-4H3;/q+1;-1 |
| InChIKey | DSYXPGFFTQBPBM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetracyanoboranuide;triethyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyanoboranuide;triethyl(methyl)azanium?
The IUPAC name of tetracyanoboranuide;triethyl(methyl)azanium (CID 87321369) is tetracyanoboranuide;triethyl(methyl)azanium.
What is the SMILES notation for tetracyanoboranuide;triethyl(methyl)azanium?
The canonical SMILES for tetracyanoboranuide;triethyl(methyl)azanium is CC[N+](C)(CC)CC.N#C[B-](C#N)(C#N)C#N.
What is the InChIKey of tetracyanoboranuide;triethyl(methyl)azanium?
The InChIKey is DSYXPGFFTQBPBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N.C4BN4/c1-5-8(4,6-2)7-3;6-1-5(2-7,3-8)4-9/h5-7H2,1-4H3;/q+1;-1.
What are the key properties of tetracyanoboranuide;triethyl(methyl)azanium?
tetracyanoboranuide;triethyl(methyl)azanium has a molecular weight of 231.11 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyanoboranuide;triethyl(methyl)azanium is sourced from PubChem (CID 87321369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).