C21H16F3N3O6S — CID 87321699
[2-amino-3'-[2-(3-methyloxetan-3-yl)ethynyl]spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate (PubChem CID 87321699) has the molecular formula C21H16F3N3O6S and a molecular weight of 495.44 g/mol. Its IUPAC name is [2-amino-3'-[2-(3-methyloxetan-3-yl)ethynyl]spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate.
| Compound Name | [2-amino-3'-[2-(3-methyloxetan-3-yl)ethynyl]spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87321699 |
| Molecular Formula | C21H16F3N3O6S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [2-amino-3'-[2-(3-methyloxetan-3-yl)ethynyl]spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
| SMILES | CC1(C#Cc2cnc3c(c2)C2(COC(N)=N2)c2cc(OS(=O)(=O)C(F)(F)F)ccc2O3)COC1 |
| InChI | InChI=1S/C21H16F3N3O6S/c1-19(9-30-10-19)5-4-12-6-15-17(26-8-12)32-16-3-2-13(33-34(28,29)21(22,23)24)7-14(16)20(15)11-31-18(25)27-20/h2-3,6-8H,9-11H2,1H3,(H2,25,27) |
| InChIKey | MPFKHVFLSLLMCF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|