C21H25FN6O3 — CID 87321784
tert-butyl (3R)-3-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]oxyamino]piperidine-1-carboxylate (PubChem CID 87321784) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]oxyamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]oxyamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87321784 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | tert-butyl (3R)-3-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)pyrimidin-4-yl]oxyamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NOc2ccnc(-c3cnc4ccc(F)cn34)n2)C1 |
| InChI | InChI=1S/C21H25FN6O3/c1-21(2,3)30-20(29)27-10-4-5-15(13-27)26-31-18-8-9-23-19(25-18)16-11-24-17-7-6-14(22)12-28(16)17/h6-9,11-12,15,26H,4-5,10,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | GRWBJXHOTMMMDJ-OAHLLOKOSA-N |
| XLogP | 3.21 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|