About tetracyanoboranuide;tetraethylazanium
tetracyanoboranuide;tetraethylazanium (PubChem CID 87321853) has the molecular formula C12H20BN5
and a molecular weight of 245.14 g/mol. Its IUPAC name is tetracyanoboranuide;tetraethylazanium.
Molecular Properties
| Compound Name | tetracyanoboranuide;tetraethylazanium |
| PubChem CID | 87321853 |
| Molecular Formula | C12H20BN5 |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | tetracyanoboranuide;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C8H20N.C4BN4/c1-5-9(6-2,7-3)8-4;6-1-5(2-7,3-8)4-9/h5-8H2,1-4H3;/q+1;-1 |
| InChIKey | OOIQBKWHYPEMRK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetracyanoboranuide;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyanoboranuide;tetraethylazanium?
The IUPAC name of tetracyanoboranuide;tetraethylazanium (CID 87321853) is tetracyanoboranuide;tetraethylazanium.
What is the SMILES notation for tetracyanoboranuide;tetraethylazanium?
The canonical SMILES for tetracyanoboranuide;tetraethylazanium is CC[N+](CC)(CC)CC.N#C[B-](C#N)(C#N)C#N.
What is the InChIKey of tetracyanoboranuide;tetraethylazanium?
The InChIKey is OOIQBKWHYPEMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C4BN4/c1-5-9(6-2,7-3)8-4;6-1-5(2-7,3-8)4-9/h5-8H2,1-4H3;/q+1;-1.
What are the key properties of tetracyanoboranuide;tetraethylazanium?
tetracyanoboranuide;tetraethylazanium has a molecular weight of 245.14 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyanoboranuide;tetraethylazanium is sourced from PubChem (CID 87321853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).