C26H37O8PSi — CID 87322156
(2R,4R)-2-[bis(phenylmethoxy)phosphorylmethyl]-4-[tert-butyl(dimethyl)silyl]oxypentanedioic acid (PubChem CID 87322156) has the molecular formula C26H37O8PSi and a molecular weight of 536.63 g/mol. Its IUPAC name is (2R,4R)-2-[bis(phenylmethoxy)phosphorylmethyl]-4-[tert-butyl(dimethyl)silyl]oxypentanedioic acid.
| Compound Name | (2R,4R)-2-[bis(phenylmethoxy)phosphorylmethyl]-4-[tert-butyl(dimethyl)silyl]oxypentanedioic acid |
|---|---|
| PubChem CID | 87322156 |
| Molecular Formula | C26H37O8PSi |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (2R,4R)-2-[bis(phenylmethoxy)phosphorylmethyl]-4-[tert-butyl(dimethyl)silyl]oxypentanedioic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C[C@@H](CP(=O)(OCc1ccccc1)OCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H37O8PSi/c1-26(2,3)36(4,5)34-23(25(29)30)16-22(24(27)28)19-35(31,32-17-20-12-8-6-9-13-20)33-18-21-14-10-7-11-15-21/h6-15,22-23H,16-19H2,1-5H3,(H,27,28)(H,29,30)/t22-,23+/m0/s1 |
| InChIKey | HXOJEJDCUAUQPU-XZOQPEGZSA-N |
| XLogP | 6.18 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|