About N-cinnolin-4-ylformamide
N-cinnolin-4-ylformamide (PubChem CID 87322157) has the molecular formula C9H7N3O
and a molecular weight of 173.18 g/mol. Its IUPAC name is N-cinnolin-4-ylformamide.
Molecular Properties
| Compound Name | N-cinnolin-4-ylformamide |
| PubChem CID | 87322157 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | N-cinnolin-4-ylformamide |
| SMILES | O=CNc1cnnc2ccccc12 |
| InChI | InChI=1S/C9H7N3O/c13-6-10-9-5-11-12-8-4-2-1-3-7(8)9/h1-6H,(H,10,12,13) |
| InChIKey | NXYKMFFMGHDKNJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-cinnolin-4-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cinnolin-4-ylformamide?
The IUPAC name of N-cinnolin-4-ylformamide (CID 87322157) is N-cinnolin-4-ylformamide.
What is the SMILES notation for N-cinnolin-4-ylformamide?
The canonical SMILES for N-cinnolin-4-ylformamide is O=CNc1cnnc2ccccc12.
What is the InChIKey of N-cinnolin-4-ylformamide?
The InChIKey is NXYKMFFMGHDKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c13-6-10-9-5-11-12-8-4-2-1-3-7(8)9/h1-6H,(H,10,12,13).
What are the key properties of N-cinnolin-4-ylformamide?
N-cinnolin-4-ylformamide has a molecular weight of 173.18 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cinnolin-4-ylformamide is sourced from PubChem (CID 87322157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).