About N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide
N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 87322372) has the molecular formula C11H19F3N2O2
and a molecular weight of 268.28 g/mol. Its IUPAC name is N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
Molecular Properties
| Compound Name | N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| PubChem CID | 87322372 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CCCNC(=O)CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c1-2-7-15-9(17)6-4-3-5-8-16-10(18)11(12,13)14/h2-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | SEGGXWKLSQFZQT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide?
The IUPAC name of N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (CID 87322372) is N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
What is the SMILES notation for N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide?
The canonical SMILES for N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide is CCCNC(=O)CCCCCNC(=O)C(F)(F)F.
What is the InChIKey of N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide?
The InChIKey is SEGGXWKLSQFZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O2/c1-2-7-15-9(17)6-4-3-5-8-16-10(18)11(12,13)14/h2-8H2,1H3,(H,15,17)(H,16,18).
What are the key properties of N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide?
N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide has a molecular weight of 268.28 g/mol, XLogP of 1.75, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide is sourced from PubChem (CID 87322372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).