C23H18BrF3N4O5S — CID 87322483
ethyl 6-bromo-5-hydroxy-1-methyl-2-[sulfinyl-[4-(trifluoromethoxy)phenyl]methyl]-4-(1,2,4-triazol-1-ylmethyl)indole-3-carboxylate (PubChem CID 87322483) has the molecular formula C23H18BrF3N4O5S and a molecular weight of 599.39 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-1-methyl-2-[sulfinyl-[4-(trifluoromethoxy)phenyl]methyl]-4-(1,2,4-triazol-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-1-methyl-2-[sulfinyl-[4-(trifluoromethoxy)phenyl]methyl]-4-(1,2,4-triazol-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 87322483 |
| Molecular Formula | C23H18BrF3N4O5S |
| Molecular Weight | 599.39 g/mol |
| Exact Mass | 598.01 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-1-methyl-2-[sulfinyl-[4-(trifluoromethoxy)phenyl]methyl]-4-(1,2,4-triazol-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(=S=O)c2ccc(OC(F)(F)F)cc2)n(C)c2cc(Br)c(O)c(Cn3cncn3)c12 |
| InChI | InChI=1S/C23H18BrF3N4O5S/c1-3-35-22(33)18-17-14(9-31-11-28-10-29-31)20(32)15(24)8-16(17)30(2)19(18)21(37-34)12-4-6-13(7-5-12)36-23(25,26)27/h4-8,10-11,32H,3,9H2,1-2H3 |
| InChIKey | OKTSCFPKGXKMGR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|