C13H19NRu — CID 87322672
penta-1,3-diene;ruthenium(2+);2,2,4,5-tetramethyl-3H-pyrrol-3-ide (PubChem CID 87322672) has the molecular formula C13H19NRu and a molecular weight of 290.37 g/mol. Its IUPAC name is penta-1,3-diene;ruthenium(2+);2,2,4,5-tetramethyl-3H-pyrrol-3-ide.
| Compound Name | penta-1,3-diene;ruthenium(2+);2,2,4,5-tetramethyl-3H-pyrrol-3-ide |
|---|---|
| PubChem CID | 87322672 |
| Molecular Formula | C13H19NRu |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | penta-1,3-diene;ruthenium(2+);2,2,4,5-tetramethyl-3H-pyrrol-3-ide |
| SMILES | CC1=[C-]C(C)(C)N=C1C.[H]/[C-]=C\C=CC.[Ru+2] |
| InChI | InChI=1S/C8H12N.C5H7.Ru/c1-6-5-8(3,4)9-7(6)2;1-3-5-4-2;/h1-4H3;1,3-5H,2H3;/q2*-1;+2 |
| InChIKey | CIBFQAYNLCRXGK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|