C16H12Cl2F4N4O2 — CID 87323036
5-[dichloro-(3,6-difluoro-2-methoxyphenyl)methyl]-2H-tetrazole;1,4-difluoro-2-methoxybenzene (PubChem CID 87323036) has the molecular formula C16H12Cl2F4N4O2 and a molecular weight of 439.20 g/mol. Its IUPAC name is 5-[dichloro-(3,6-difluoro-2-methoxyphenyl)methyl]-2H-tetrazole;1,4-difluoro-2-methoxybenzene.
| Compound Name | 5-[dichloro-(3,6-difluoro-2-methoxyphenyl)methyl]-2H-tetrazole;1,4-difluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 87323036 |
| Molecular Formula | C16H12Cl2F4N4O2 |
| Molecular Weight | 439.20 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 5-[dichloro-(3,6-difluoro-2-methoxyphenyl)methyl]-2H-tetrazole;1,4-difluoro-2-methoxybenzene |
| SMILES | COc1c(F)ccc(F)c1C(Cl)(Cl)c1nn[nH]n1.COc1cc(F)ccc1F |
| InChI | InChI=1S/C9H6Cl2F2N4O.C7H6F2O/c1-18-7-5(13)3-2-4(12)6(7)9(10,11)8-14-16-17-15-8;1-10-7-4-5(8)2-3-6(7)9/h2-3H,1H3,(H,14,15,16,17);2-4H,1H3 |
| InChIKey | IALRBNLMZZLAQZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|