C13H17NRu — CID 87323295
2,5-dimethyl-1,3-dihydropyrrol-3-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 87323295) has the molecular formula C13H17NRu and a molecular weight of 288.36 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-dihydropyrrol-3-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+).
| Compound Name | 2,5-dimethyl-1,3-dihydropyrrol-3-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) |
|---|---|
| PubChem CID | 87323295 |
| Molecular Formula | C13H17NRu |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2,5-dimethyl-1,3-dihydropyrrol-3-ide;2-ethylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | CCC1=[C-]CC=C1.Cc1[c-]cc(C)[nH]1.[Ru+2] |
| InChI | InChI=1S/C7H9.C6H8N.Ru/c1-2-7-5-3-4-6-7;1-5-3-4-6(2)7-5;/h3,5H,2,4H2,1H3;3,7H,1-2H3;/q2*-1;+2 |
| InChIKey | OOKRHRDJXOMNBM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|