C21H18F3N3O5S — CID 87323354
[2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate (PubChem CID 87323354) has the molecular formula C21H18F3N3O5S and a molecular weight of 481.45 g/mol. Its IUPAC name is [2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate.
| Compound Name | [2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87323354 |
| Molecular Formula | C21H18F3N3O5S |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [2-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[5H-1,3-oxazole-4,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)C#Cc1cnc2c(c1)C1(COC(N)=N1)c1cc(OS(=O)(=O)C(F)(F)F)ccc1O2 |
| InChI | InChI=1S/C21H18F3N3O5S/c1-19(2,3)7-6-12-8-15-17(26-10-12)31-16-5-4-13(32-33(28,29)21(22,23)24)9-14(16)20(15)11-30-18(25)27-20/h4-5,8-10H,11H2,1-3H3,(H2,25,27) |
| InChIKey | KUEJSBKAQMZFMA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|