About (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate
(4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate (PubChem CID 87323815) has the molecular formula C17H18FNO4S
and a molecular weight of 351.40 g/mol. Its IUPAC name is (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate |
| PubChem CID | 87323815 |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)OCCCC(N)=O)ccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO4S/c1-12-11-15(24(21,22)23-10-2-3-17(19)20)8-9-16(12)13-4-6-14(18)7-5-13/h4-9,11H,2-3,10H2,1H3,(H2,19,20) |
| InChIKey | GPLBQWPBGQIVET-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate?
The IUPAC name of (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate (CID 87323815) is (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate.
What is the SMILES notation for (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate?
The canonical SMILES for (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate is Cc1cc(S(=O)(=O)OCCCC(N)=O)ccc1-c1ccc(F)cc1.
What is the InChIKey of (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate?
The InChIKey is GPLBQWPBGQIVET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO4S/c1-12-11-15(24(21,22)23-10-2-3-17(19)20)8-9-16(12)13-4-6-14(18)7-5-13/h4-9,11H,2-3,10H2,1H3,(H2,19,20).
What are the key properties of (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate?
(4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate has a molecular weight of 351.40 g/mol, XLogP of 2.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-oxobutyl) 4-(4-fluorophenyl)-3-methylbenzenesulfonate is sourced from PubChem (CID 87323815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).