C23H15Cl2F2N3OS — CID 87323955
5-(2-chlorophenyl)-2-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 87323955) has the molecular formula C23H15Cl2F2N3OS and a molecular weight of 490.36 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-2-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(2-chlorophenyl)-2-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 87323955 |
| Molecular Formula | C23H15Cl2F2N3OS |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 5-(2-chlorophenyl)-2-[[(2S,3R)-3-(2-chlorophenyl)-2-(2,4-difluorophenyl)oxiran-2-yl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc([C@@]2(Cn3[nH]c(-c4ccccc4Cl)nc3=S)O[C@@H]2c2ccccc2Cl)c(F)c1 |
| InChI | InChI=1S/C23H15Cl2F2N3OS/c24-17-7-3-1-5-14(17)20-23(31-20,16-10-9-13(26)11-19(16)27)12-30-22(32)28-21(29-30)15-6-2-4-8-18(15)25/h1-11,20H,12H2,(H,28,29,32)/t20-,23-/m1/s1 |
| InChIKey | KNMAXVSEDDQWSR-NFBKMPQASA-N |
| XLogP | 6.86 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|