C41H70ClN7O2 — CID 87324802
6-chloro-2-N,4-N-bis[4-(1-cyclohex-3-en-1-yloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4-diamine (PubChem CID 87324802) has the molecular formula C41H70ClN7O2 and a molecular weight of 728.51 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis[4-(1-cyclohex-3-en-1-yloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis[4-(1-cyclohex-3-en-1-yloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87324802 |
| Molecular Formula | C41H70ClN7O2 |
| Molecular Weight | 728.51 g/mol |
| Exact Mass | 727.53 |
| IUPAC Name | 6-chloro-2-N,4-N-bis[4-(1-cyclohex-3-en-1-yloxy-2,2,6,6-tetramethylpiperidin-4-yl)butyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)CC(CCCCNc2nc(Cl)nc(NCCCCC3CC(C)(C)N(OC4CC=CCC4)C(C)(C)C3)n2)CC(C)(C)N1OC1CC=CCC1 |
| InChI | InChI=1S/C41H70ClN7O2/c1-38(2)27-31(28-39(3,4)48(38)50-33-21-11-9-12-22-33)19-15-17-25-43-36-45-35(42)46-37(47-36)44-26-18-16-20-32-29-40(5,6)49(41(7,8)30-32)51-34-23-13-10-14-24-34/h9-11,13,31-34H,12,14-30H2,1-8H3,(H2,43,44,45,46,47) |
| InChIKey | RYAOEHGFQNMGSE-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.51 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|