About 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene
2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene (PubChem CID 87324900) has the molecular formula C16H6N4O6S
and a molecular weight of 382.31 g/mol. Its IUPAC name is 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene.
Molecular Properties
| Compound Name | 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene |
| PubChem CID | 87324900 |
| Molecular Formula | C16H6N4O6S |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene |
| SMILES | O=C=Nc1cccc(N=C=O)c1S(=O)(=O)c1c(N=C=O)cccc1N=C=O |
| InChI | InChI=1S/C16H6N4O6S/c21-7-17-11-3-1-4-12(18-8-22)15(11)27(25,26)16-13(19-9-23)5-2-6-14(16)20-10-24/h1-6H |
| InChIKey | FWEJZEUERCHNPN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 151.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene?
The IUPAC name of 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene (CID 87324900) is 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene.
What is the SMILES notation for 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene?
The canonical SMILES for 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene is O=C=Nc1cccc(N=C=O)c1S(=O)(=O)c1c(N=C=O)cccc1N=C=O.
What is the InChIKey of 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene?
The InChIKey is FWEJZEUERCHNPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6N4O6S/c21-7-17-11-3-1-4-12(18-8-22)15(11)27(25,26)16-13(19-9-23)5-2-6-14(16)20-10-24/h1-6H.
What are the key properties of 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene?
2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene has a molecular weight of 382.31 g/mol, XLogP of 2.39, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diisocyanatophenyl)sulfonyl-1,3-diisocyanatobenzene is sourced from PubChem (CID 87324900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).