C32H42N2O4 — CID 87324905
1-[2-amino-4,5-dimethoxy-3-[[4-[2-(3-methylbutylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 87324905) has the molecular formula C32H42N2O4 and a molecular weight of 518.70 g/mol. Its IUPAC name is 1-[2-amino-4,5-dimethoxy-3-[[4-[2-(3-methylbutylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-[2-amino-4,5-dimethoxy-3-[[4-[2-(3-methylbutylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 87324905 |
| Molecular Formula | C32H42N2O4 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | 1-[2-amino-4,5-dimethoxy-3-[[4-[2-(3-methylbutylamino)ethoxy]phenyl]methyl]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(-c2c(O)ccc3c2CCCC3)c(N)c(Cc2ccc(OCCNCCC(C)C)cc2)c1OC |
| InChI | InChI=1S/C32H42N2O4/c1-21(2)15-16-34-17-18-38-24-12-9-22(10-13-24)19-27-31(33)26(20-29(36-3)32(27)37-4)30-25-8-6-5-7-23(25)11-14-28(30)35/h9-14,20-21,34-35H,5-8,15-19,33H2,1-4H3 |
| InChIKey | SDGCRKOKFLHNQG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|