C12H2F16O — CID 87325238
3,3,4-trifluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-[3,4,4-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobuten-1-yl]oxycyclobutene (PubChem CID 87325238) has the molecular formula C12H2F16O and a molecular weight of 466.12 g/mol. Its IUPAC name is 3,3,4-trifluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-[3,4,4-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobuten-1-yl]oxycyclobutene.
| Compound Name | 3,3,4-trifluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-[3,4,4-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobuten-1-yl]oxycyclobutene |
|---|---|
| PubChem CID | 87325238 |
| Molecular Formula | C12H2F16O |
| Molecular Weight | 466.12 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 3,3,4-trifluoro-1-(1,1,2,2,2-pentafluoroethyl)-2-[3,4,4-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)cyclobuten-1-yl]oxycyclobutene |
| SMILES | FC1C(C(F)(F)C(F)(F)F)=C(OC2=C(C(F)(F)C(F)(F)F)C(F)C2(F)F)C1(F)F |
| InChI | InChI=1S/C12H2F16O/c13-3-1(9(19,20)11(23,24)25)5(7(3,15)16)29-6-2(4(14)8(6,17)18)10(21,22)12(26,27)28/h3-4H |
| InChIKey | AYXSWOBEBGILOL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.12 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|