C21H19FN2S — CID 87326395
1-[1-(3-fluorophenyl)spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,1'-cyclopropane]-2-yl]ethanethione (PubChem CID 87326395) has the molecular formula C21H19FN2S and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,1'-cyclopropane]-2-yl]ethanethione.
| Compound Name | 1-[1-(3-fluorophenyl)spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,1'-cyclopropane]-2-yl]ethanethione |
|---|---|
| PubChem CID | 87326395 |
| Molecular Formula | C21H19FN2S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[1-(3-fluorophenyl)spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,1'-cyclopropane]-2-yl]ethanethione |
| SMILES | CC(=S)N1CC2(CC2)c2c([nH]c3ccccc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H19FN2S/c1-13(25)24-12-21(9-10-21)18-16-7-2-3-8-17(16)23-19(18)20(24)14-5-4-6-15(22)11-14/h2-8,11,20,23H,9-10,12H2,1H3 |
| InChIKey | CLWVMRFYFNEYMM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|