About 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid
4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid (PubChem CID 87326471) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid |
| PubChem CID | 87326471 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid |
| SMILES | CC(=CC(CO)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H18O3/c1-7(9(12)13)5-8(6-11)10(2,3)4/h5,8,11H,6H2,1-4H3,(H,12,13) |
| InChIKey | VCJMPAKXBQDIKW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The IUPAC name of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid (CID 87326471) is 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid.
What is the SMILES notation for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The canonical SMILES for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid is CC(=CC(CO)C(C)(C)C)C(=O)O.
What is the InChIKey of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The InChIKey is VCJMPAKXBQDIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7(9(12)13)5-8(6-11)10(2,3)4/h5,8,11H,6H2,1-4H3,(H,12,13).
What are the key properties of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid has a molecular weight of 186.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid is sourced from PubChem (CID 87326471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).