4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid

C10H18O3 — CID 87326471

IUPAC4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid
SMILESCC(=CC(CO)C(C)(C)C)C(=O)O
InChIInChI=1S/C10H18O3/c1-7(9(12)13)5-8(6-11)10(2,3)4/h5,8,11H,6H2,1-4H3,(H,12,13)
InChIKeyVCJMPAKXBQDIKW-UHFFFAOYSA-N
MW186.25 g/mol
LogP1.67
Rot. Bonds3

About 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid

4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid (PubChem CID 87326471) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid.

Molecular Properties

Compound Name4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid
PubChem CID87326471
Molecular FormulaC10H18O3
Molecular Weight186.25 g/mol
Exact Mass186.13
IUPAC Name4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid
SMILESCC(=CC(CO)C(C)(C)C)C(=O)O
InChIInChI=1S/C10H18O3/c1-7(9(12)13)5-8(6-11)10(2,3)4/h5,8,11H,6H2,1-4H3,(H,12,13)
InChIKeyVCJMPAKXBQDIKW-UHFFFAOYSA-N
XLogP1.67
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 51.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The IUPAC name of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid (CID 87326471) is 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid.
What is the SMILES notation for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The canonical SMILES for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid is CC(=CC(CO)C(C)(C)C)C(=O)O.
What is the InChIKey of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
The InChIKey is VCJMPAKXBQDIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-7(9(12)13)5-8(6-11)10(2,3)4/h5,8,11H,6H2,1-4H3,(H,12,13).
What are the key properties of 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid?
4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid has a molecular weight of 186.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,5,5-trimethylhex-2-enoic acid is sourced from PubChem (CID 87326471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).