C22H31Cl3N2O3 — CID 87326718
(3R,4S)-7-chloro-2,2,9-trimethyl-4-[2-(oxan-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol;dihydrochloride (PubChem CID 87326718) has the molecular formula C22H31Cl3N2O3 and a molecular weight of 477.86 g/mol. Its IUPAC name is (3R,4S)-7-chloro-2,2,9-trimethyl-4-[2-(oxan-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol;dihydrochloride.
| Compound Name | (3R,4S)-7-chloro-2,2,9-trimethyl-4-[2-(oxan-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 87326718 |
| Molecular Formula | C22H31Cl3N2O3 |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (3R,4S)-7-chloro-2,2,9-trimethyl-4-[2-(oxan-4-yl)ethylamino]-3,4-dihydropyrano[2,3-g]quinolin-3-ol;dihydrochloride |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCCC1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C22H29ClN2O3.2ClH/c1-13-10-19(23)25-17-11-16-18(12-15(13)17)28-22(2,3)21(26)20(16)24-7-4-14-5-8-27-9-6-14;;/h10-12,14,20-21,24,26H,4-9H2,1-3H3;2*1H/t20-,21+;;/m0../s1 |
| InChIKey | AQOJQNBXMBTEMV-DDZPGPNZSA-N |
| XLogP | 5.02 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|