About 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one
10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one (PubChem CID 87327008) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one.
Molecular Properties
| Compound Name | 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one |
| PubChem CID | 87327008 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one |
| SMILES | CCCCCCC1=C2C=C3C=CC=CC3N(CC)C2=CCC1=O |
| InChI | InChI=1S/C21H27NO/c1-3-5-6-7-11-17-18-15-16-10-8-9-12-19(16)22(4-2)20(18)13-14-21(17)23/h8-10,12-13,15,19H,3-7,11,14H2,1-2H3 |
| InChIKey | HMUYYRVFZKLZPT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one?
The IUPAC name of 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one (CID 87327008) is 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one.
What is the SMILES notation for 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one?
The canonical SMILES for 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one is CCCCCCC1=C2C=C3C=CC=CC3N(CC)C2=CCC1=O.
What is the InChIKey of 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one?
The InChIKey is HMUYYRVFZKLZPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO/c1-3-5-6-7-11-17-18-15-16-10-8-9-12-19(16)22(4-2)20(18)13-14-21(17)23/h8-10,12-13,15,19H,3-7,11,14H2,1-2H3.
What are the key properties of 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one?
10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one has a molecular weight of 309.45 g/mol, XLogP of 4.87, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethyl-1-hexyl-3,10a-dihydroacridin-2-one is sourced from PubChem (CID 87327008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).