About 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline
4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline (PubChem CID 87327246) has the molecular formula C12H11NS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline.
Molecular Properties
| Compound Name | 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline |
| PubChem CID | 87327246 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline |
| SMILES | C1=CC2NC=c3ccccc3=C2CS1 |
| InChI | InChI=1S/C12H11NS/c1-2-4-10-9(3-1)7-13-12-5-6-14-8-11(10)12/h1-7,12-13H,8H2 |
| InChIKey | BTKIDJBVJSBJLM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline?
The IUPAC name of 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline (CID 87327246) is 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline.
What is the SMILES notation for 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline?
The canonical SMILES for 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline is C1=CC2NC=c3ccccc3=C2CS1.
What is the InChIKey of 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline?
The InChIKey is BTKIDJBVJSBJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS/c1-2-4-10-9(3-1)7-13-12-5-6-14-8-11(10)12/h1-7,12-13H,8H2.
What are the key properties of 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline?
4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline has a molecular weight of 201.29 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5-dihydro-1H-thiopyrano[4,3-c]isoquinoline is sourced from PubChem (CID 87327246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).