About 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde
5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde (PubChem CID 87327285) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde |
| PubChem CID | 87327285 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c(c2)C(=O)NCC3)s1 |
| InChI | InChI=1S/C14H11NO2S/c16-8-11-3-4-13(18-11)10-2-1-9-5-6-15-14(17)12(9)7-10/h1-4,7-8H,5-6H2,(H,15,17) |
| InChIKey | BLPCQYHBAZRMLE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde?
The IUPAC name of 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde (CID 87327285) is 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde.
What is the SMILES notation for 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde?
The canonical SMILES for 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde is O=Cc1ccc(-c2ccc3c(c2)C(=O)NCC3)s1.
What is the InChIKey of 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde?
The InChIKey is BLPCQYHBAZRMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c16-8-11-3-4-13(18-11)10-2-1-9-5-6-15-14(17)12(9)7-10/h1-4,7-8H,5-6H2,(H,15,17).
What are the key properties of 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde?
5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde has a molecular weight of 257.31 g/mol, XLogP of 2.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-oxo-3,4-dihydro-2H-isoquinolin-7-yl)thiophene-2-carbaldehyde is sourced from PubChem (CID 87327285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).