About benzaldehyde;pyridine;2-(trifluoromethyl)pyridine
benzaldehyde;pyridine;2-(trifluoromethyl)pyridine (PubChem CID 87327506) has the molecular formula C18H15F3N2O
and a molecular weight of 332.33 g/mol. Its IUPAC name is benzaldehyde;pyridine;2-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | benzaldehyde;pyridine;2-(trifluoromethyl)pyridine |
| PubChem CID | 87327506 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | benzaldehyde;pyridine;2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccccn1.O=Cc1ccccc1.c1ccncc1 |
| InChI | InChI=1S/C7H6O.C6H4F3N.C5H5N/c8-6-7-4-2-1-3-5-7;7-6(8,9)5-3-1-2-4-10-5;1-2-4-6-5-3-1/h1-6H;1-4H;1-5H |
| InChIKey | AUQABPGCAJQMSR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;pyridine;2-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;pyridine;2-(trifluoromethyl)pyridine?
The IUPAC name of benzaldehyde;pyridine;2-(trifluoromethyl)pyridine (CID 87327506) is benzaldehyde;pyridine;2-(trifluoromethyl)pyridine.
What is the SMILES notation for benzaldehyde;pyridine;2-(trifluoromethyl)pyridine?
The canonical SMILES for benzaldehyde;pyridine;2-(trifluoromethyl)pyridine is FC(F)(F)c1ccccn1.O=Cc1ccccc1.c1ccncc1.
What is the InChIKey of benzaldehyde;pyridine;2-(trifluoromethyl)pyridine?
The InChIKey is AUQABPGCAJQMSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C6H4F3N.C5H5N/c8-6-7-4-2-1-3-5-7;7-6(8,9)5-3-1-2-4-10-5;1-2-4-6-5-3-1/h1-6H;1-4H;1-5H.
What are the key properties of benzaldehyde;pyridine;2-(trifluoromethyl)pyridine?
benzaldehyde;pyridine;2-(trifluoromethyl)pyridine has a molecular weight of 332.33 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;pyridine;2-(trifluoromethyl)pyridine is sourced from PubChem (CID 87327506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).