About pyrazolo[4,3-a]carbazole
pyrazolo[4,3-a]carbazole (PubChem CID 87327690) has the molecular formula C13H7N3
and a molecular weight of 205.22 g/mol. Its IUPAC name is pyrazolo[4,3-a]carbazole.
Molecular Properties
| Compound Name | pyrazolo[4,3-a]carbazole |
| PubChem CID | 87327690 |
| Molecular Formula | C13H7N3 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | pyrazolo[4,3-a]carbazole |
| SMILES | C1=NN=c2ccc3c(c21)N=c1ccccc1=3 |
| InChI | InChI=1S/C13H7N3/c1-2-4-11-8(3-1)9-5-6-12-10(7-14-16-12)13(9)15-11/h1-7H |
| InChIKey | JMBOGXKIRYENPO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[4,3-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[4,3-a]carbazole?
The IUPAC name of pyrazolo[4,3-a]carbazole (CID 87327690) is pyrazolo[4,3-a]carbazole.
What is the SMILES notation for pyrazolo[4,3-a]carbazole?
The canonical SMILES for pyrazolo[4,3-a]carbazole is C1=NN=c2ccc3c(c21)N=c1ccccc1=3.
What is the InChIKey of pyrazolo[4,3-a]carbazole?
The InChIKey is JMBOGXKIRYENPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3/c1-2-4-11-8(3-1)9-5-6-12-10(7-14-16-12)13(9)15-11/h1-7H.
What are the key properties of pyrazolo[4,3-a]carbazole?
pyrazolo[4,3-a]carbazole has a molecular weight of 205.22 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[4,3-a]carbazole is sourced from PubChem (CID 87327690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).