About nonylaluminum(2+) difluoride
nonylaluminum(2+) difluoride (PubChem CID 87327880) has the molecular formula C9H19AlF2
and a molecular weight of 192.23 g/mol. Its IUPAC name is nonylaluminum(2+) difluoride.
Molecular Properties
| Compound Name | nonylaluminum(2+) difluoride |
| PubChem CID | 87327880 |
| Molecular Formula | C9H19AlF2 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | nonylaluminum(2+) difluoride |
| SMILES | CCCCCCCCC[Al+2].[F-].[F-] |
| InChI | InChI=1S/C9H19.Al.2FH/c1-3-5-7-9-8-6-4-2;;;/h1,3-9H2,2H3;;2*1H/q;+2;;/p-2 |
| InChIKey | CKTNZPVPCHJNQX-UHFFFAOYSA-L |
| XLogP | -2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonylaluminum(2+) difluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonylaluminum(2+) difluoride?
The IUPAC name of nonylaluminum(2+) difluoride (CID 87327880) is nonylaluminum(2+) difluoride.
What is the SMILES notation for nonylaluminum(2+) difluoride?
The canonical SMILES for nonylaluminum(2+) difluoride is CCCCCCCCC[Al+2].[F-].[F-].
What is the InChIKey of nonylaluminum(2+) difluoride?
The InChIKey is CKTNZPVPCHJNQX-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H19.Al.2FH/c1-3-5-7-9-8-6-4-2;;;/h1,3-9H2,2H3;;2*1H/q;+2;;/p-2.
What are the key properties of nonylaluminum(2+) difluoride?
nonylaluminum(2+) difluoride has a molecular weight of 192.23 g/mol, XLogP of -2.67, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonylaluminum(2+) difluoride is sourced from PubChem (CID 87327880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).