About 6-chloro-3-sulfanyl-2H-1,3-benzothiazole
6-chloro-3-sulfanyl-2H-1,3-benzothiazole (PubChem CID 87328124) has the molecular formula C7H6ClNS2
and a molecular weight of 203.72 g/mol. Its IUPAC name is 6-chloro-3-sulfanyl-2H-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-chloro-3-sulfanyl-2H-1,3-benzothiazole |
| PubChem CID | 87328124 |
| Molecular Formula | C7H6ClNS2 |
| Molecular Weight | 203.72 g/mol |
| Exact Mass | 202.96 |
| IUPAC Name | 6-chloro-3-sulfanyl-2H-1,3-benzothiazole |
| SMILES | SN1CSc2cc(Cl)ccc21 |
| InChI | InChI=1S/C7H6ClNS2/c8-5-1-2-6-7(3-5)11-4-9(6)10/h1-3,10H,4H2 |
| InChIKey | FXULADHAKAJMDI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-sulfanyl-2H-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-sulfanyl-2H-1,3-benzothiazole?
The IUPAC name of 6-chloro-3-sulfanyl-2H-1,3-benzothiazole (CID 87328124) is 6-chloro-3-sulfanyl-2H-1,3-benzothiazole.
What is the SMILES notation for 6-chloro-3-sulfanyl-2H-1,3-benzothiazole?
The canonical SMILES for 6-chloro-3-sulfanyl-2H-1,3-benzothiazole is SN1CSc2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-3-sulfanyl-2H-1,3-benzothiazole?
The InChIKey is FXULADHAKAJMDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNS2/c8-5-1-2-6-7(3-5)11-4-9(6)10/h1-3,10H,4H2.
What are the key properties of 6-chloro-3-sulfanyl-2H-1,3-benzothiazole?
6-chloro-3-sulfanyl-2H-1,3-benzothiazole has a molecular weight of 203.72 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-sulfanyl-2H-1,3-benzothiazole is sourced from PubChem (CID 87328124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).