About (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine
(E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine (PubChem CID 87328270) has the molecular formula C11H26N2O2Si2
and a molecular weight of 274.51 g/mol. Its IUPAC name is (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine.
Molecular Properties
| Compound Name | (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine |
| PubChem CID | 87328270 |
| Molecular Formula | C11H26N2O2Si2 |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine |
| SMILES | C[Si](C)(C)O/N=C/CCC/C=N/O[Si](C)(C)C |
| InChI | InChI=1S/C11H26N2O2Si2/c1-16(2,3)14-12-10-8-7-9-11-13-15-17(4,5)6/h10-11H,7-9H2,1-6H3/b12-10+,13-11+ |
| InChIKey | KAGSEJGVRSVJLR-DCIPZJNNSA-N |
| XLogP | 3.83 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine?
The IUPAC name of (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine (CID 87328270) is (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine.
What is the SMILES notation for (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine?
The canonical SMILES for (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine is C[Si](C)(C)O/N=C/CCC/C=N/O[Si](C)(C)C.
What is the InChIKey of (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine?
The InChIKey is KAGSEJGVRSVJLR-DCIPZJNNSA-N. The full InChI is InChI=1S/C11H26N2O2Si2/c1-16(2,3)14-12-10-8-7-9-11-13-15-17(4,5)6/h10-11H,7-9H2,1-6H3/b12-10+,13-11+.
What are the key properties of (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine?
(E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine has a molecular weight of 274.51 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-bis(trimethylsilyloxy)pentane-1,5-diimine is sourced from PubChem (CID 87328270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).