About 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine
1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine (PubChem CID 87328335) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine.
Molecular Properties
| Compound Name | 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine |
| PubChem CID | 87328335 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine |
| SMILES | CON=C1C=CC=CC1=NOC |
| InChI | InChI=1S/C8H10N2O2/c1-11-9-7-5-3-4-6-8(7)10-12-2/h3-6H,1-2H3 |
| InChIKey | QLKMPZJGTWXIHC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine?
The IUPAC name of 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine (CID 87328335) is 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine.
What is the SMILES notation for 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine?
The canonical SMILES for 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine is CON=C1C=CC=CC1=NOC.
What is the InChIKey of 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine?
The InChIKey is QLKMPZJGTWXIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-11-9-7-5-3-4-6-8(7)10-12-2/h3-6H,1-2H3.
What are the key properties of 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine?
1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine has a molecular weight of 166.18 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dimethoxycyclohexa-3,5-diene-1,2-diimine is sourced from PubChem (CID 87328335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).