C20H14Cl4N2O2 — CID 87328504
3,4,5,6-tetrachloro-1-N,2-N-bis(phenylmethoxy)cyclohexa-3,5-diene-1,2-diimine (PubChem CID 87328504) has the molecular formula C20H14Cl4N2O2 and a molecular weight of 456.16 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-1-N,2-N-bis(phenylmethoxy)cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3,4,5,6-tetrachloro-1-N,2-N-bis(phenylmethoxy)cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 87328504 |
| Molecular Formula | C20H14Cl4N2O2 |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 3,4,5,6-tetrachloro-1-N,2-N-bis(phenylmethoxy)cyclohexa-3,5-diene-1,2-diimine |
| SMILES | ClC1=C(Cl)C(Cl)=C(Cl)C(=NOCc2ccccc2)C1=NOCc1ccccc1 |
| InChI | InChI=1S/C20H14Cl4N2O2/c21-15-16(22)18(24)20(26-28-12-14-9-5-2-6-10-14)19(17(15)23)25-27-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | GGSRQCOROJWHHY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|