4-chloro-1,3,5-triazine-2-sulfonyl chloride

C3HCl2N3O2S — CID 87328580

IUPAC4-chloro-1,3,5-triazine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ncnc(Cl)n1
InChIInChI=1S/C3HCl2N3O2S/c4-2-6-1-7-3(8-2)11(5,9)10/h1H
InChIKeyHLQZKYCYWKAUJQ-UHFFFAOYSA-N
MW214.03 g/mol
LogP0.45
Rot. Bonds1

About 4-chloro-1,3,5-triazine-2-sulfonyl chloride

4-chloro-1,3,5-triazine-2-sulfonyl chloride (PubChem CID 87328580) has the molecular formula C3HCl2N3O2S and a molecular weight of 214.03 g/mol. Its IUPAC name is 4-chloro-1,3,5-triazine-2-sulfonyl chloride.

Molecular Properties

Compound Name4-chloro-1,3,5-triazine-2-sulfonyl chloride
PubChem CID87328580
Molecular FormulaC3HCl2N3O2S
Molecular Weight214.03 g/mol
Exact Mass212.92
IUPAC Name4-chloro-1,3,5-triazine-2-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ncnc(Cl)n1
InChIInChI=1S/C3HCl2N3O2S/c4-2-6-1-7-3(8-2)11(5,9)10/h1H
InChIKeyHLQZKYCYWKAUJQ-UHFFFAOYSA-N
XLogP0.45
TPSA72.81 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.03
LogP ≤ 50.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 4-chloro-1,3,5-triazine-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-1,3,5-triazine-2-sulfonyl chloride?
The IUPAC name of 4-chloro-1,3,5-triazine-2-sulfonyl chloride (CID 87328580) is 4-chloro-1,3,5-triazine-2-sulfonyl chloride.
What is the SMILES notation for 4-chloro-1,3,5-triazine-2-sulfonyl chloride?
The canonical SMILES for 4-chloro-1,3,5-triazine-2-sulfonyl chloride is O=S(=O)(Cl)c1ncnc(Cl)n1.
What is the InChIKey of 4-chloro-1,3,5-triazine-2-sulfonyl chloride?
The InChIKey is HLQZKYCYWKAUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HCl2N3O2S/c4-2-6-1-7-3(8-2)11(5,9)10/h1H.
What are the key properties of 4-chloro-1,3,5-triazine-2-sulfonyl chloride?
4-chloro-1,3,5-triazine-2-sulfonyl chloride has a molecular weight of 214.03 g/mol, XLogP of 0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3,5-triazine-2-sulfonyl chloride is sourced from PubChem (CID 87328580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).