C25H25N3O9S3 — CID 87328764
[(E)-[(6E)-4,6-bis(benzenesulfonyloxyimino)heptan-2-ylidene]amino] benzenesulfonate (PubChem CID 87328764) has the molecular formula C25H25N3O9S3 and a molecular weight of 607.69 g/mol. Its IUPAC name is [(E)-[(6E)-4,6-bis(benzenesulfonyloxyimino)heptan-2-ylidene]amino] benzenesulfonate.
| Compound Name | [(E)-[(6E)-4,6-bis(benzenesulfonyloxyimino)heptan-2-ylidene]amino] benzenesulfonate |
|---|---|
| PubChem CID | 87328764 |
| Molecular Formula | C25H25N3O9S3 |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.08 |
| IUPAC Name | [(E)-[(6E)-4,6-bis(benzenesulfonyloxyimino)heptan-2-ylidene]amino] benzenesulfonate |
| SMILES | C/C(CC(C/C(C)=N/OS(=O)(=O)c1ccccc1)=NOS(=O)(=O)c1ccccc1)=N\OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O9S3/c1-20(26-35-38(29,30)23-12-6-3-7-13-23)18-22(28-37-40(33,34)25-16-10-5-11-17-25)19-21(2)27-36-39(31,32)24-14-8-4-9-15-24/h3-17H,18-19H2,1-2H3/b26-20+,27-21+ |
| InChIKey | JPLVEJPDFDMUBB-CRYYDKFDSA-N |
| XLogP | 4.09 |
| TPSA | 167.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|