C12H13NS — CID 87328920
3,4,4a,5-tetrahydro-1H-thiopyrano[4,3-c]isoquinoline (PubChem CID 87328920) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 3,4,4a,5-tetrahydro-1H-thiopyrano[4,3-c]isoquinoline.
| Compound Name | 3,4,4a,5-tetrahydro-1H-thiopyrano[4,3-c]isoquinoline |
|---|---|
| PubChem CID | 87328920 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3,4,4a,5-tetrahydro-1H-thiopyrano[4,3-c]isoquinoline |
| SMILES | C1=c2ccccc2=C2CSCCC2N1 |
| InChI | InChI=1S/C12H13NS/c1-2-4-10-9(3-1)7-13-12-5-6-14-8-11(10)12/h1-4,7,12-13H,5-6,8H2 |
| InChIKey | GHTFWYMIDIOZEM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |