About [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate
[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate (PubChem CID 87328991) has the molecular formula C18H14FNO4S
and a molecular weight of 359.38 g/mol. Its IUPAC name is [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate.
Molecular Properties
| Compound Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate |
| PubChem CID | 87328991 |
| Molecular Formula | C18H14FNO4S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate |
| SMILES | O=C(Cc1ccccc1F)Oc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C18H14FNO4S/c19-14-4-2-1-3-12(14)10-16(21)24-13-7-5-11(6-8-13)9-15-17(22)20-18(23)25-15/h1-8,15H,9-10H2,(H,20,22,23) |
| InChIKey | VBIBGJPNUNUHQL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate?
The IUPAC name of [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate (CID 87328991) is [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate.
What is the SMILES notation for [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate?
The canonical SMILES for [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate is O=C(Cc1ccccc1F)Oc1ccc(CC2SC(=O)NC2=O)cc1.
What is the InChIKey of [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate?
The InChIKey is VBIBGJPNUNUHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNO4S/c19-14-4-2-1-3-12(14)10-16(21)24-13-7-5-11(6-8-13)9-15-17(22)20-18(23)25-15/h1-8,15H,9-10H2,(H,20,22,23).
What are the key properties of [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate?
[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate has a molecular weight of 359.38 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl] 2-(2-fluorophenyl)acetate is sourced from PubChem (CID 87328991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).