About benzo[c]chromen-1-one
benzo[c]chromen-1-one (PubChem CID 87329071) has the molecular formula C13H8O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is benzo[c]chromen-1-one.
Molecular Properties
| Compound Name | benzo[c]chromen-1-one |
| PubChem CID | 87329071 |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | benzo[c]chromen-1-one |
| SMILES | O=c1cccc2occ3ccccc3c1-2 |
| InChI | InChI=1S/C13H8O2/c14-11-6-3-7-12-13(11)10-5-2-1-4-9(10)8-15-12/h1-8H |
| InChIKey | ASIPLGLDOUQLOQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[c]chromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c]chromen-1-one?
The IUPAC name of benzo[c]chromen-1-one (CID 87329071) is benzo[c]chromen-1-one.
What is the SMILES notation for benzo[c]chromen-1-one?
The canonical SMILES for benzo[c]chromen-1-one is O=c1cccc2occ3ccccc3c1-2.
What is the InChIKey of benzo[c]chromen-1-one?
The InChIKey is ASIPLGLDOUQLOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O2/c14-11-6-3-7-12-13(11)10-5-2-1-4-9(10)8-15-12/h1-8H.
What are the key properties of benzo[c]chromen-1-one?
benzo[c]chromen-1-one has a molecular weight of 196.21 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c]chromen-1-one is sourced from PubChem (CID 87329071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).