About 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene
2,4-diisocyanato-1-methylbenzene;isocyanatobenzene (PubChem CID 87329283) has the molecular formula C16H11N3O3
and a molecular weight of 293.28 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene.
Molecular Properties
| Compound Name | 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene |
| PubChem CID | 87329283 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene |
| SMILES | Cc1ccc(N=C=O)cc1N=C=O.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C9H6N2O2.C7H5NO/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;9-6-8-7-4-2-1-3-5-7/h2-4H,1H3;1-5H |
| InChIKey | WYCINMIXHXBPRF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene?
The IUPAC name of 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene (CID 87329283) is 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene.
What is the SMILES notation for 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene?
The canonical SMILES for 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene is Cc1ccc(N=C=O)cc1N=C=O.O=C=Nc1ccccc1.
What is the InChIKey of 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene?
The InChIKey is WYCINMIXHXBPRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.C7H5NO/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;9-6-8-7-4-2-1-3-5-7/h2-4H,1H3;1-5H.
What are the key properties of 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene?
2,4-diisocyanato-1-methylbenzene;isocyanatobenzene has a molecular weight of 293.28 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanato-1-methylbenzene;isocyanatobenzene is sourced from PubChem (CID 87329283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).