C14H12F14O8S2 — CID 87329471
benzene-1,4-diol;bis(2,2,3,3,4,4,4-heptafluorobutane-1-sulfonic acid) (PubChem CID 87329471) has the molecular formula C14H12F14O8S2 and a molecular weight of 638.35 g/mol. Its IUPAC name is benzene-1,4-diol;bis(2,2,3,3,4,4,4-heptafluorobutane-1-sulfonic acid).
| Compound Name | benzene-1,4-diol;bis(2,2,3,3,4,4,4-heptafluorobutane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87329471 |
| Molecular Formula | C14H12F14O8S2 |
| Molecular Weight | 638.35 g/mol |
| Exact Mass | 637.98 |
| IUPAC Name | benzene-1,4-diol;bis(2,2,3,3,4,4,4-heptafluorobutane-1-sulfonic acid) |
| SMILES | O=S(=O)(O)CC(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)CC(F)(F)C(F)(F)C(F)(F)F.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.2C4H3F7O3S/c7-5-1-2-6(8)4-3-5;2*5-2(6,1-15(12,13)14)3(7,8)4(9,10)11/h1-4,7-8H;2*1H2,(H,12,13,14) |
| InChIKey | GHZZLAGLVYIWMG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|