C25H27F4N7O2 — CID 87330540
4-[4-[1-[2-(dimethylamino)ethyl]-4-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazol-2-yl]-4-hydroxypiperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 87330540) has the molecular formula C25H27F4N7O2 and a molecular weight of 533.53 g/mol. Its IUPAC name is 4-[4-[1-[2-(dimethylamino)ethyl]-4-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazol-2-yl]-4-hydroxypiperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-[4-[1-[2-(dimethylamino)ethyl]-4-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazol-2-yl]-4-hydroxypiperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 87330540 |
| Molecular Formula | C25H27F4N7O2 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 4-[4-[1-[2-(dimethylamino)ethyl]-4-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazol-2-yl]-4-hydroxypiperidin-1-yl]-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1c(F)c(F)c(F)c(-c2cn(CCN(C)C)c(C3(O)CCN(c4ncnc5c4CC(=O)N5)CC3)n2)c1F |
| InChI | InChI=1S/C25H27F4N7O2/c1-13-18(26)17(20(28)21(29)19(13)27)15-11-36(9-8-34(2)3)24(32-15)25(38)4-6-35(7-5-25)23-14-10-16(37)33-22(14)30-12-31-23/h11-12,38H,4-10H2,1-3H3,(H,30,31,33,37) |
| InChIKey | SMGZJUYMDDHPNI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|