C76H92N4 — CID 87330571
5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin (PubChem CID 87330571) has the molecular formula C76H92N4 and a molecular weight of 1061.60 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin.
| Compound Name | 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin |
|---|---|
| PubChem CID | 87330571 |
| Molecular Formula | C76H92N4 |
| Molecular Weight | 1061.60 g/mol |
| Exact Mass | 1060.73 |
| IUPAC Name | 5,10,15,20-tetrakis(3,5-ditert-butylphenyl)porphyrin |
| SMILES | CC(C)(C)c1cc(/C2=C3\C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC2=N3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C76H92N4/c1-69(2,3)49-33-45(34-50(41-49)70(4,5)6)65-57-25-27-59(77-57)66(46-35-51(71(7,8)9)42-52(36-46)72(10,11)12)61-29-31-63(79-61)68(48-39-55(75(19,20)21)44-56(40-48)76(22,23)24)64-32-30-62(80-64)67(60-28-26-58(65)78-60)47-37-53(73(13,14)15)43-54(38-47)74(16,17)18/h25-44H,1-24H3/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | IVLMYHDAFKLGPG-ZOUHOBQGSA-N |
| XLogP | 20.07 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.60 |
| LogP ≤ 5 | 20.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |