About 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane
6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane (PubChem CID 87331014) has the molecular formula C7H9BrF6
and a molecular weight of 287.04 g/mol. Its IUPAC name is 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane.
Molecular Properties
| Compound Name | 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane |
| PubChem CID | 87331014 |
| Molecular Formula | C7H9BrF6 |
| Molecular Weight | 287.04 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane |
| SMILES | FC(F)(F)C(CCCCBr)C(F)(F)F |
| InChI | InChI=1S/C7H9BrF6/c8-4-2-1-3-5(6(9,10)11)7(12,13)14/h5H,1-4H2 |
| InChIKey | BNDRMNLHWPRMGH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.04 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane?
The IUPAC name of 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane (CID 87331014) is 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane.
What is the SMILES notation for 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane?
The canonical SMILES for 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane is FC(F)(F)C(CCCCBr)C(F)(F)F.
What is the InChIKey of 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane?
The InChIKey is BNDRMNLHWPRMGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrF6/c8-4-2-1-3-5(6(9,10)11)7(12,13)14/h5H,1-4H2.
What are the key properties of 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane?
6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane has a molecular weight of 287.04 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,1,1-trifluoro-2-(trifluoromethyl)hexane is sourced from PubChem (CID 87331014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).